C15H25ClN2O3 — CID 62844684
1-(3-chlorophenoxy)-3-[2-[2-methoxyethyl(methyl)amino]ethylamino]propan-2-ol (PubChem CID 62844684) has the molecular formula C15H25ClN2O3 and a molecular weight of 316.83 g/mol. Its IUPAC name is 1-(3-chlorophenoxy)-3-[2-[2-methoxyethyl(methyl)amino]ethylamino]propan-2-ol.
| Compound Name | 1-(3-chlorophenoxy)-3-[2-[2-methoxyethyl(methyl)amino]ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 62844684 |
| Molecular Formula | C15H25ClN2O3 |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-(3-chlorophenoxy)-3-[2-[2-methoxyethyl(methyl)amino]ethylamino]propan-2-ol |
| SMILES | COCCN(C)CCNCC(O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H25ClN2O3/c1-18(8-9-20-2)7-6-17-11-14(19)12-21-15-5-3-4-13(16)10-15/h3-5,10,14,17,19H,6-9,11-12H2,1-2H3 |
| InChIKey | VCAFENZXENOHKX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|