C16H16N2OS2 — CID 62845316
5-(3-aminoprop-1-ynyl)-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)thiophene-2-carboxamide (PubChem CID 62845316) has the molecular formula C16H16N2OS2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 5-(3-aminoprop-1-ynyl)-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)thiophene-2-carboxamide.
| Compound Name | 5-(3-aminoprop-1-ynyl)-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 62845316 |
| Molecular Formula | C16H16N2OS2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 5-(3-aminoprop-1-ynyl)-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)thiophene-2-carboxamide |
| SMILES | NCC#Cc1ccc(C(=O)NC2CCCc3sccc32)s1 |
| InChI | InChI=1S/C16H16N2OS2/c17-9-2-3-11-6-7-15(21-11)16(19)18-13-4-1-5-14-12(13)8-10-20-14/h6-8,10,13H,1,4-5,9,17H2,(H,18,19) |
| InChIKey | DIIKOMSMQYMKCU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|