C13H15N5OS — CID 62845505
6-hydrazinyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pyridazine-3-carboxamide (PubChem CID 62845505) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is 6-hydrazinyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pyridazine-3-carboxamide.
| Compound Name | 6-hydrazinyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62845505 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 6-hydrazinyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)pyridazine-3-carboxamide |
| SMILES | NNc1ccc(C(=O)NC2CCCc3sccc32)nn1 |
| InChI | InChI=1S/C13H15N5OS/c14-16-12-5-4-10(17-18-12)13(19)15-9-2-1-3-11-8(9)6-7-20-11/h4-7,9H,1-3,14H2,(H,15,19)(H,16,18) |
| InChIKey | ATBHVLYVVZKFOW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|