C12H15N3S — CID 6284692
1-[(Z)-2,3-dihydroinden-1-ylideneamino]-3-ethylthiourea (PubChem CID 6284692) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is 1-[(Z)-2,3-dihydroinden-1-ylideneamino]-3-ethylthiourea.
| Compound Name | 1-[(Z)-2,3-dihydroinden-1-ylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 6284692 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 1-[(Z)-2,3-dihydroinden-1-ylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)N/N=C1/CCc2ccccc21 |
| InChI | InChI=1S/C12H15N3S/c1-2-13-12(16)15-14-11-8-7-9-5-3-4-6-10(9)11/h3-6H,2,7-8H2,1H3,(H2,13,15,16)/b14-11- |
| InChIKey | YMYRUFILLTVSQN-KAMYIIQDSA-N |
| XLogP | 1.82 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|