About tricyclohexylgermane
tricyclohexylgermane (PubChem CID 6284880) has the molecular formula C18H34Ge
and a molecular weight of 323.08 g/mol. Its IUPAC name is tricyclohexylgermane.
Molecular Properties
| Compound Name | tricyclohexylgermane |
| PubChem CID | 6284880 |
| Molecular Formula | C18H34Ge |
| Molecular Weight | 323.08 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | tricyclohexylgermane |
| SMILES | C1CCC([GeH](C2CCCCC2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C18H34Ge/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h16-19H,1-15H2 |
| InChIKey | NRWOPCVDOCNGPX-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.08 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tricyclohexylgermane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclohexylgermane?
The IUPAC name of tricyclohexylgermane (CID 6284880) is tricyclohexylgermane.
What is the SMILES notation for tricyclohexylgermane?
The canonical SMILES for tricyclohexylgermane is C1CCC([GeH](C2CCCCC2)C2CCCCC2)CC1.
What is the InChIKey of tricyclohexylgermane?
The InChIKey is NRWOPCVDOCNGPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34Ge/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h16-19H,1-15H2.
What are the key properties of tricyclohexylgermane?
tricyclohexylgermane has a molecular weight of 323.08 g/mol, XLogP of 6.22, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclohexylgermane is sourced from PubChem (CID 6284880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).