C12H14ClN3O2S — CID 62849139
3-[(5-chlorothiophen-2-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 62849139) has the molecular formula C12H14ClN3O2S and a molecular weight of 299.78 g/mol. Its IUPAC name is 3-[(5-chlorothiophen-2-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(5-chlorothiophen-2-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 62849139 |
| Molecular Formula | C12H14ClN3O2S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 3-[(5-chlorothiophen-2-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC2(CCNCC2)C(=O)N1Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H14ClN3O2S/c13-9-2-1-8(19-9)7-16-10(17)12(15-11(16)18)3-5-14-6-4-12/h1-2,14H,3-7H2,(H,15,18) |
| InChIKey | DTGBMHCGEXREBG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|