C13H18N2O2 — CID 62849698
N-(2-methoxyethyl)-1,2,3,4-tetrahydroquinoline-5-carboxamide (PubChem CID 62849698) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1,2,3,4-tetrahydroquinoline-5-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1,2,3,4-tetrahydroquinoline-5-carboxamide |
|---|---|
| PubChem CID | 62849698 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N-(2-methoxyethyl)-1,2,3,4-tetrahydroquinoline-5-carboxamide |
| SMILES | COCCNC(=O)c1cccc2c1CCCN2 |
| InChI | InChI=1S/C13H18N2O2/c1-17-9-8-15-13(16)11-4-2-6-12-10(11)5-3-7-14-12/h2,4,6,14H,3,5,7-9H2,1H3,(H,15,16) |
| InChIKey | XFEGCJQBBQZMPN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|