C15H13N3OS2 — CID 62850007
4-[5-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)thiophen-3-yl]but-3-yn-1-ol (PubChem CID 62850007) has the molecular formula C15H13N3OS2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 4-[5-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)thiophen-3-yl]but-3-yn-1-ol.
| Compound Name | 4-[5-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)thiophen-3-yl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 62850007 |
| Molecular Formula | C15H13N3OS2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 4-[5-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)thiophen-3-yl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1csc(CSc2nnc3ccccn23)c1 |
| InChI | InChI=1S/C15H13N3OS2/c19-8-4-2-5-12-9-13(20-10-12)11-21-15-17-16-14-6-1-3-7-18(14)15/h1,3,6-7,9-10,19H,4,8,11H2 |
| InChIKey | JRSFZHRUFRJECN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|