About 2-[(2-amino-1,3-thiazol-4-yl)methyl]pyridazin-3-one
2-[(2-amino-1,3-thiazol-4-yl)methyl]pyridazin-3-one (PubChem CID 62850138) has the molecular formula C8H8N4OS
and a molecular weight of 208.25 g/mol. Its IUPAC name is 2-[(2-amino-1,3-thiazol-4-yl)methyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 2-[(2-amino-1,3-thiazol-4-yl)methyl]pyridazin-3-one |
| PubChem CID | 62850138 |
| Molecular Formula | C8H8N4OS |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 2-[(2-amino-1,3-thiazol-4-yl)methyl]pyridazin-3-one |
| SMILES | Nc1nc(Cn2ncccc2=O)cs1 |
| InChI | InChI=1S/C8H8N4OS/c9-8-11-6(5-14-8)4-12-7(13)2-1-3-10-12/h1-3,5H,4H2,(H2,9,11) |
| InChIKey | KYDFZCMXHIYRQU-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(2-amino-1,3-thiazol-4-yl)methyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-amino-1,3-thiazol-4-yl)methyl]pyridazin-3-one?
The IUPAC name of 2-[(2-amino-1,3-thiazol-4-yl)methyl]pyridazin-3-one (CID 62850138) is 2-[(2-amino-1,3-thiazol-4-yl)methyl]pyridazin-3-one.
What is the SMILES notation for 2-[(2-amino-1,3-thiazol-4-yl)methyl]pyridazin-3-one?
The canonical SMILES for 2-[(2-amino-1,3-thiazol-4-yl)methyl]pyridazin-3-one is Nc1nc(Cn2ncccc2=O)cs1.
What is the InChIKey of 2-[(2-amino-1,3-thiazol-4-yl)methyl]pyridazin-3-one?
The InChIKey is KYDFZCMXHIYRQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4OS/c9-8-11-6(5-14-8)4-12-7(13)2-1-3-10-12/h1-3,5H,4H2,(H2,9,11).
What are the key properties of 2-[(2-amino-1,3-thiazol-4-yl)methyl]pyridazin-3-one?
2-[(2-amino-1,3-thiazol-4-yl)methyl]pyridazin-3-one has a molecular weight of 208.25 g/mol, XLogP of 0.33, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-amino-1,3-thiazol-4-yl)methyl]pyridazin-3-one is sourced from PubChem (CID 62850138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).