About 5-quinoxalin-6-yl-1,3,4-oxadiazol-2-amine
5-quinoxalin-6-yl-1,3,4-oxadiazol-2-amine (PubChem CID 62850606) has the molecular formula C10H7N5O
and a molecular weight of 213.20 g/mol. Its IUPAC name is 5-quinoxalin-6-yl-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | 5-quinoxalin-6-yl-1,3,4-oxadiazol-2-amine |
| PubChem CID | 62850606 |
| Molecular Formula | C10H7N5O |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 5-quinoxalin-6-yl-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(-c2ccc3nccnc3c2)o1 |
| InChI | InChI=1S/C10H7N5O/c11-10-15-14-9(16-10)6-1-2-7-8(5-6)13-4-3-12-7/h1-5H,(H2,11,15) |
| InChIKey | YMINFJYMBMEPHE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-quinoxalin-6-yl-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-quinoxalin-6-yl-1,3,4-oxadiazol-2-amine?
The IUPAC name of 5-quinoxalin-6-yl-1,3,4-oxadiazol-2-amine (CID 62850606) is 5-quinoxalin-6-yl-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for 5-quinoxalin-6-yl-1,3,4-oxadiazol-2-amine?
The canonical SMILES for 5-quinoxalin-6-yl-1,3,4-oxadiazol-2-amine is Nc1nnc(-c2ccc3nccnc3c2)o1.
What is the InChIKey of 5-quinoxalin-6-yl-1,3,4-oxadiazol-2-amine?
The InChIKey is YMINFJYMBMEPHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N5O/c11-10-15-14-9(16-10)6-1-2-7-8(5-6)13-4-3-12-7/h1-5H,(H2,11,15).
What are the key properties of 5-quinoxalin-6-yl-1,3,4-oxadiazol-2-amine?
5-quinoxalin-6-yl-1,3,4-oxadiazol-2-amine has a molecular weight of 213.20 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-quinoxalin-6-yl-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 62850606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).