About (NZ)-N-(3-butyl-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine
(NZ)-N-(3-butyl-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine (PubChem CID 6285086) has the molecular formula C17H20N2O2
and a molecular weight of 284.36 g/mol. Its IUPAC name is (NZ)-N-(3-butyl-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-(3-butyl-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine |
| PubChem CID | 6285086 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (NZ)-N-(3-butyl-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine |
| SMILES | CCCCc1noc2c1/C(=N\O)CC(c1ccccc1)C2 |
| InChI | InChI=1S/C17H20N2O2/c1-2-3-9-14-17-15(18-20)10-13(11-16(17)21-19-14)12-7-5-4-6-8-12/h4-8,13,20H,2-3,9-11H2,1H3/b18-15- |
| InChIKey | DDYXNPSRXOROOT-SDXDJHTJSA-N |
| XLogP | 3.93 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-(3-butyl-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-(3-butyl-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine?
The IUPAC name of (NZ)-N-(3-butyl-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine (CID 6285086) is (NZ)-N-(3-butyl-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine.
What is the SMILES notation for (NZ)-N-(3-butyl-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine?
The canonical SMILES for (NZ)-N-(3-butyl-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine is CCCCc1noc2c1/C(=N\O)CC(c1ccccc1)C2.
What is the InChIKey of (NZ)-N-(3-butyl-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine?
The InChIKey is DDYXNPSRXOROOT-SDXDJHTJSA-N. The full InChI is InChI=1S/C17H20N2O2/c1-2-3-9-14-17-15(18-20)10-13(11-16(17)21-19-14)12-7-5-4-6-8-12/h4-8,13,20H,2-3,9-11H2,1H3/b18-15-.
What are the key properties of (NZ)-N-(3-butyl-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine?
(NZ)-N-(3-butyl-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine has a molecular weight of 284.36 g/mol, XLogP of 3.93, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-(3-butyl-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine is sourced from PubChem (CID 6285086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).