C11H22N2O3 — CID 62851658
methyl 2-[[3-(ethylamino)-2-methylpropanoyl]amino]-2-methylpropanoate (PubChem CID 62851658) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is methyl 2-[[3-(ethylamino)-2-methylpropanoyl]amino]-2-methylpropanoate.
| Compound Name | methyl 2-[[3-(ethylamino)-2-methylpropanoyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 62851658 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | methyl 2-[[3-(ethylamino)-2-methylpropanoyl]amino]-2-methylpropanoate |
| SMILES | CCNCC(C)C(=O)NC(C)(C)C(=O)OC |
| InChI | InChI=1S/C11H22N2O3/c1-6-12-7-8(2)9(14)13-11(3,4)10(15)16-5/h8,12H,6-7H2,1-5H3,(H,13,14) |
| InChIKey | IAYDDGCKOVJXAY-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |