C8H16N2O3 — CID 62852267
3-[(2-aminoacetyl)-ethylamino]-2-methylpropanoic acid (PubChem CID 62852267) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-[(2-aminoacetyl)-ethylamino]-2-methylpropanoic acid.
| Compound Name | 3-[(2-aminoacetyl)-ethylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62852267 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 3-[(2-aminoacetyl)-ethylamino]-2-methylpropanoic acid |
| SMILES | CCN(CC(C)C(=O)O)C(=O)CN |
| InChI | InChI=1S/C8H16N2O3/c1-3-10(7(11)4-9)5-6(2)8(12)13/h6H,3-5,9H2,1-2H3,(H,12,13) |
| InChIKey | OTAQFGIIIOBOKM-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |