C14H24N4O3 — CID 62852861
3-[ethyl-[3-(5-methyl-1H-pyrazol-4-yl)propylcarbamoyl]amino]-2-methylpropanoic acid (PubChem CID 62852861) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-[ethyl-[3-(5-methyl-1H-pyrazol-4-yl)propylcarbamoyl]amino]-2-methylpropanoic acid.
| Compound Name | 3-[ethyl-[3-(5-methyl-1H-pyrazol-4-yl)propylcarbamoyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62852861 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 3-[ethyl-[3-(5-methyl-1H-pyrazol-4-yl)propylcarbamoyl]amino]-2-methylpropanoic acid |
| SMILES | CCN(CC(C)C(=O)O)C(=O)NCCCc1cn[nH]c1C |
| InChI | InChI=1S/C14H24N4O3/c1-4-18(9-10(2)13(19)20)14(21)15-7-5-6-12-8-16-17-11(12)3/h8,10H,4-7,9H2,1-3H3,(H,15,21)(H,16,17)(H,19,20) |
| InChIKey | BQLAPNUDELGRRR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|