About N-[(2,4-dimethylphenyl)methyl]-3-(ethylamino)-N,2-dimethylpropanamide
N-[(2,4-dimethylphenyl)methyl]-3-(ethylamino)-N,2-dimethylpropanamide (PubChem CID 62853116) has the molecular formula C16H26N2O
and a molecular weight of 262.40 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)methyl]-3-(ethylamino)-N,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[(2,4-dimethylphenyl)methyl]-3-(ethylamino)-N,2-dimethylpropanamide |
| PubChem CID | 62853116 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | N-[(2,4-dimethylphenyl)methyl]-3-(ethylamino)-N,2-dimethylpropanamide |
| SMILES | CCNCC(C)C(=O)N(C)Cc1ccc(C)cc1C |
| InChI | InChI=1S/C16H26N2O/c1-6-17-10-14(4)16(19)18(5)11-15-8-7-12(2)9-13(15)3/h7-9,14,17H,6,10-11H2,1-5H3 |
| InChIKey | GQTZQUFYBYTSFP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2,4-dimethylphenyl)methyl]-3-(ethylamino)-N,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,4-dimethylphenyl)methyl]-3-(ethylamino)-N,2-dimethylpropanamide?
The IUPAC name of N-[(2,4-dimethylphenyl)methyl]-3-(ethylamino)-N,2-dimethylpropanamide (CID 62853116) is N-[(2,4-dimethylphenyl)methyl]-3-(ethylamino)-N,2-dimethylpropanamide.
What is the SMILES notation for N-[(2,4-dimethylphenyl)methyl]-3-(ethylamino)-N,2-dimethylpropanamide?
The canonical SMILES for N-[(2,4-dimethylphenyl)methyl]-3-(ethylamino)-N,2-dimethylpropanamide is CCNCC(C)C(=O)N(C)Cc1ccc(C)cc1C.
What is the InChIKey of N-[(2,4-dimethylphenyl)methyl]-3-(ethylamino)-N,2-dimethylpropanamide?
The InChIKey is GQTZQUFYBYTSFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O/c1-6-17-10-14(4)16(19)18(5)11-15-8-7-12(2)9-13(15)3/h7-9,14,17H,6,10-11H2,1-5H3.
What are the key properties of N-[(2,4-dimethylphenyl)methyl]-3-(ethylamino)-N,2-dimethylpropanamide?
N-[(2,4-dimethylphenyl)methyl]-3-(ethylamino)-N,2-dimethylpropanamide has a molecular weight of 262.40 g/mol, XLogP of 2.51, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,4-dimethylphenyl)methyl]-3-(ethylamino)-N,2-dimethylpropanamide is sourced from PubChem (CID 62853116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).