C11H12BrNO3 — CID 62854835
3-(2-bromobutanoylamino)benzoic acid (PubChem CID 62854835) has the molecular formula C11H12BrNO3 and a molecular weight of 286.12 g/mol. Its IUPAC name is 3-(2-bromobutanoylamino)benzoic acid.
| Compound Name | 3-(2-bromobutanoylamino)benzoic acid |
|---|---|
| PubChem CID | 62854835 |
| Molecular Formula | C11H12BrNO3 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 3-(2-bromobutanoylamino)benzoic acid |
| SMILES | CCC(Br)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C11H12BrNO3/c1-2-9(12)10(14)13-8-5-3-4-7(6-8)11(15)16/h3-6,9H,2H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | KPMZYDGYQPSXIH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|