C14H18BrNO — CID 62855378
2-bromo-N-(2,3-dihydro-1H-inden-1-yl)-N-methylbutanamide (PubChem CID 62855378) has the molecular formula C14H18BrNO and a molecular weight of 296.21 g/mol. Its IUPAC name is 2-bromo-N-(2,3-dihydro-1H-inden-1-yl)-N-methylbutanamide.
| Compound Name | 2-bromo-N-(2,3-dihydro-1H-inden-1-yl)-N-methylbutanamide |
|---|---|
| PubChem CID | 62855378 |
| Molecular Formula | C14H18BrNO |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-bromo-N-(2,3-dihydro-1H-inden-1-yl)-N-methylbutanamide |
| SMILES | CCC(Br)C(=O)N(C)C1CCc2ccccc21 |
| InChI | InChI=1S/C14H18BrNO/c1-3-12(15)14(17)16(2)13-9-8-10-6-4-5-7-11(10)13/h4-7,12-13H,3,8-9H2,1-2H3 |
| InChIKey | BVLDGINKWSQGKZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|