C11H19BrN2O — CID 62855966
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-bromobutan-1-one (PubChem CID 62855966) has the molecular formula C11H19BrN2O and a molecular weight of 275.19 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-bromobutan-1-one.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-bromobutan-1-one |
|---|---|
| PubChem CID | 62855966 |
| Molecular Formula | C11H19BrN2O |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-bromobutan-1-one |
| SMILES | CCC(Br)C(=O)N1CCN2CCCC2C1 |
| InChI | InChI=1S/C11H19BrN2O/c1-2-10(12)11(15)14-7-6-13-5-3-4-9(13)8-14/h9-10H,2-8H2,1H3 |
| InChIKey | NDEDSOBHOUOTLZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|