About 1-bromo-2,3,5,6-tetrachloro-4-fluorobenzene
1-bromo-2,3,5,6-tetrachloro-4-fluorobenzene (PubChem CID 628565) has the molecular formula C6BrCl4F
and a molecular weight of 312.78 g/mol. Its IUPAC name is 1-bromo-2,3,5,6-tetrachloro-4-fluorobenzene.
Molecular Properties
| Compound Name | 1-bromo-2,3,5,6-tetrachloro-4-fluorobenzene |
| PubChem CID | 628565 |
| Molecular Formula | C6BrCl4F |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 309.79 |
| IUPAC Name | 1-bromo-2,3,5,6-tetrachloro-4-fluorobenzene |
| SMILES | Fc1c(Cl)c(Cl)c(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C6BrCl4F/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| InChIKey | PMBJPOHVLKGCTF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2,3,5,6-tetrachloro-4-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,3,5,6-tetrachloro-4-fluorobenzene?
The IUPAC name of 1-bromo-2,3,5,6-tetrachloro-4-fluorobenzene (CID 628565) is 1-bromo-2,3,5,6-tetrachloro-4-fluorobenzene.
What is the SMILES notation for 1-bromo-2,3,5,6-tetrachloro-4-fluorobenzene?
The canonical SMILES for 1-bromo-2,3,5,6-tetrachloro-4-fluorobenzene is Fc1c(Cl)c(Cl)c(Br)c(Cl)c1Cl.
What is the InChIKey of 1-bromo-2,3,5,6-tetrachloro-4-fluorobenzene?
The InChIKey is PMBJPOHVLKGCTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6BrCl4F/c7-1-2(8)4(10)6(12)5(11)3(1)9.
What are the key properties of 1-bromo-2,3,5,6-tetrachloro-4-fluorobenzene?
1-bromo-2,3,5,6-tetrachloro-4-fluorobenzene has a molecular weight of 312.78 g/mol, XLogP of 5.20, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,3,5,6-tetrachloro-4-fluorobenzene is sourced from PubChem (CID 628565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).