C16H19BrN2O2 — CID 62856831
1-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-bromobutan-1-one (PubChem CID 62856831) has the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. Its IUPAC name is 1-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-bromobutan-1-one.
| Compound Name | 1-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-bromobutan-1-one |
|---|---|
| PubChem CID | 62856831 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 1-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-bromobutan-1-one |
| SMILES | CCC(Br)C(=O)N1CCC(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C16H19BrN2O2/c1-2-12(17)16(20)19-9-7-11(8-10-19)15-18-13-5-3-4-6-14(13)21-15/h3-6,11-12H,2,7-10H2,1H3 |
| InChIKey | BBHZIYHZIRYLLJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|