About [1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol
[1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol (PubChem CID 62857029) has the molecular formula C11H17ClN4O2
and a molecular weight of 272.74 g/mol. Its IUPAC name is [1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol |
| PubChem CID | 62857029 |
| Molecular Formula | C11H17ClN4O2 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | [1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol |
| SMILES | CCOc1nc(Cl)nc(N2CCC(CO)CC2)n1 |
| InChI | InChI=1S/C11H17ClN4O2/c1-2-18-11-14-9(12)13-10(15-11)16-5-3-8(7-17)4-6-16/h8,17H,2-7H2,1H3 |
| InChIKey | YEIRJIURBLXIJB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 71.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol?
The IUPAC name of [1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol (CID 62857029) is [1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol.
What is the SMILES notation for [1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol?
The canonical SMILES for [1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol is CCOc1nc(Cl)nc(N2CCC(CO)CC2)n1.
What is the InChIKey of [1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol?
The InChIKey is YEIRJIURBLXIJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClN4O2/c1-2-18-11-14-9(12)13-10(15-11)16-5-3-8(7-17)4-6-16/h8,17H,2-7H2,1H3.
What are the key properties of [1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol?
[1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol has a molecular weight of 272.74 g/mol, XLogP of 1.13, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol is sourced from PubChem (CID 62857029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).