About 1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)azepane
1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)azepane (PubChem CID 62857383) has the molecular formula C11H17ClN4O
and a molecular weight of 256.74 g/mol. Its IUPAC name is 1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)azepane.
Molecular Properties
| Compound Name | 1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)azepane |
| PubChem CID | 62857383 |
| Molecular Formula | C11H17ClN4O |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)azepane |
| SMILES | CCOc1nc(Cl)nc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C11H17ClN4O/c1-2-17-11-14-9(12)13-10(15-11)16-7-5-3-4-6-8-16/h2-8H2,1H3 |
| InChIKey | OQMLRWYIPCJLFR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)azepane?
The IUPAC name of 1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)azepane (CID 62857383) is 1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)azepane.
What is the SMILES notation for 1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)azepane?
The canonical SMILES for 1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)azepane is CCOc1nc(Cl)nc(N2CCCCCC2)n1.
What is the InChIKey of 1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)azepane?
The InChIKey is OQMLRWYIPCJLFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClN4O/c1-2-17-11-14-9(12)13-10(15-11)16-7-5-3-4-6-8-16/h2-8H2,1H3.
What are the key properties of 1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)azepane?
1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)azepane has a molecular weight of 256.74 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)azepane is sourced from PubChem (CID 62857383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).