C16H18N4O — CID 62858258
N-ethyl-1-(5-quinolin-6-yl-1,3,4-oxadiazol-2-yl)propan-1-amine (PubChem CID 62858258) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is N-ethyl-1-(5-quinolin-6-yl-1,3,4-oxadiazol-2-yl)propan-1-amine.
| Compound Name | N-ethyl-1-(5-quinolin-6-yl-1,3,4-oxadiazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 62858258 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-ethyl-1-(5-quinolin-6-yl-1,3,4-oxadiazol-2-yl)propan-1-amine |
| SMILES | CCNC(CC)c1nnc(-c2ccc3ncccc3c2)o1 |
| InChI | InChI=1S/C16H18N4O/c1-3-13(17-4-2)16-20-19-15(21-16)12-7-8-14-11(10-12)6-5-9-18-14/h5-10,13,17H,3-4H2,1-2H3 |
| InChIKey | LMLBQGWVFXQXEG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |