C12H8ClN5O3 — CID 62858487
5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]isoindole-1,3-dione (PubChem CID 62858487) has the molecular formula C12H8ClN5O3 and a molecular weight of 305.68 g/mol. Its IUPAC name is 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]isoindole-1,3-dione.
| Compound Name | 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 62858487 |
| Molecular Formula | C12H8ClN5O3 |
| Molecular Weight | 305.68 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]isoindole-1,3-dione |
| SMILES | COc1nc(Cl)nc(Nc2ccc3c(c2)C(=O)NC3=O)n1 |
| InChI | InChI=1S/C12H8ClN5O3/c1-21-12-17-10(13)16-11(18-12)14-5-2-3-6-7(4-5)9(20)15-8(6)19/h2-4H,1H3,(H,15,19,20)(H,14,16,17,18) |
| InChIKey | ACGSRYDQJXOTKQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.68 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|