C10H7ClN4O3S — CID 62858855
2-chloro-4-methoxy-6-(4-nitrophenyl)sulfanyl-1,3,5-triazine (PubChem CID 62858855) has the molecular formula C10H7ClN4O3S and a molecular weight of 298.71 g/mol. Its IUPAC name is 2-chloro-4-methoxy-6-(4-nitrophenyl)sulfanyl-1,3,5-triazine.
| Compound Name | 2-chloro-4-methoxy-6-(4-nitrophenyl)sulfanyl-1,3,5-triazine |
|---|---|
| PubChem CID | 62858855 |
| Molecular Formula | C10H7ClN4O3S |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 2-chloro-4-methoxy-6-(4-nitrophenyl)sulfanyl-1,3,5-triazine |
| SMILES | COc1nc(Cl)nc(Sc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C10H7ClN4O3S/c1-18-9-12-8(11)13-10(14-9)19-7-4-2-6(3-5-7)15(16)17/h2-5H,1H3 |
| InChIKey | CENILILBBOPUSW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 91.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|