C8H7ClN4OS2 — CID 62859083
2-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)sulfanyl]-1,3-thiazole (PubChem CID 62859083) has the molecular formula C8H7ClN4OS2 and a molecular weight of 274.76 g/mol. Its IUPAC name is 2-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)sulfanyl]-1,3-thiazole.
| Compound Name | 2-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)sulfanyl]-1,3-thiazole |
|---|---|
| PubChem CID | 62859083 |
| Molecular Formula | C8H7ClN4OS2 |
| Molecular Weight | 274.76 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 2-[(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)sulfanyl]-1,3-thiazole |
| SMILES | CCOc1nc(Cl)nc(Sc2nccs2)n1 |
| InChI | InChI=1S/C8H7ClN4OS2/c1-2-14-6-11-5(9)12-7(13-6)16-8-10-3-4-15-8/h3-4H,2H2,1H3 |
| InChIKey | GKVPIKDKEXOMPI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.76 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|