About 2-(3-iodophenoxy)-4,6-dimethoxy-1,3,5-triazine
2-(3-iodophenoxy)-4,6-dimethoxy-1,3,5-triazine (PubChem CID 62859977) has the molecular formula C11H10IN3O3
and a molecular weight of 359.12 g/mol. Its IUPAC name is 2-(3-iodophenoxy)-4,6-dimethoxy-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-(3-iodophenoxy)-4,6-dimethoxy-1,3,5-triazine |
| PubChem CID | 62859977 |
| Molecular Formula | C11H10IN3O3 |
| Molecular Weight | 359.12 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | 2-(3-iodophenoxy)-4,6-dimethoxy-1,3,5-triazine |
| SMILES | COc1nc(OC)nc(Oc2cccc(I)c2)n1 |
| InChI | InChI=1S/C11H10IN3O3/c1-16-9-13-10(17-2)15-11(14-9)18-8-5-3-4-7(12)6-8/h3-6H,1-2H3 |
| InChIKey | TXYSBARKFGDFQR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.12 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-iodophenoxy)-4,6-dimethoxy-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-iodophenoxy)-4,6-dimethoxy-1,3,5-triazine?
The IUPAC name of 2-(3-iodophenoxy)-4,6-dimethoxy-1,3,5-triazine (CID 62859977) is 2-(3-iodophenoxy)-4,6-dimethoxy-1,3,5-triazine.
What is the SMILES notation for 2-(3-iodophenoxy)-4,6-dimethoxy-1,3,5-triazine?
The canonical SMILES for 2-(3-iodophenoxy)-4,6-dimethoxy-1,3,5-triazine is COc1nc(OC)nc(Oc2cccc(I)c2)n1.
What is the InChIKey of 2-(3-iodophenoxy)-4,6-dimethoxy-1,3,5-triazine?
The InChIKey is TXYSBARKFGDFQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10IN3O3/c1-16-9-13-10(17-2)15-11(14-9)18-8-5-3-4-7(12)6-8/h3-6H,1-2H3.
What are the key properties of 2-(3-iodophenoxy)-4,6-dimethoxy-1,3,5-triazine?
2-(3-iodophenoxy)-4,6-dimethoxy-1,3,5-triazine has a molecular weight of 359.12 g/mol, XLogP of 2.29, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-iodophenoxy)-4,6-dimethoxy-1,3,5-triazine is sourced from PubChem (CID 62859977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).