C12H15N5O2 — CID 62860362
N-[(4-aminophenyl)methyl]-4,6-dimethoxy-1,3,5-triazin-2-amine (PubChem CID 62860362) has the molecular formula C12H15N5O2 and a molecular weight of 261.29 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-4,6-dimethoxy-1,3,5-triazin-2-amine.
| Compound Name | N-[(4-aminophenyl)methyl]-4,6-dimethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 62860362 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-4,6-dimethoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(NCc2ccc(N)cc2)nc(OC)n1 |
| InChI | InChI=1S/C12H15N5O2/c1-18-11-15-10(16-12(17-11)19-2)14-7-8-3-5-9(13)6-4-8/h3-6H,7,13H2,1-2H3,(H,14,15,16,17) |
| InChIKey | ANLBMKXLRZXMDL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|