C5H8N4O4S — CID 62860558
4,6-dimethoxy-1,3,5-triazine-2-sulfonamide (PubChem CID 62860558) has the molecular formula C5H8N4O4S and a molecular weight of 220.21 g/mol. Its IUPAC name is 4,6-dimethoxy-1,3,5-triazine-2-sulfonamide.
| Compound Name | 4,6-dimethoxy-1,3,5-triazine-2-sulfonamide |
|---|---|
| PubChem CID | 62860558 |
| Molecular Formula | C5H8N4O4S |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 4,6-dimethoxy-1,3,5-triazine-2-sulfonamide |
| SMILES | COc1nc(OC)nc(S(N)(=O)=O)n1 |
| InChI | InChI=1S/C5H8N4O4S/c1-12-3-7-4(13-2)9-5(8-3)14(6,10)11/h1-2H3,(H2,6,10,11) |
| InChIKey | XQIQDSVLFCRCLC-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |