About 4,6-dimethyl-1-(1,2-oxazol-5-ylmethyl)-2-oxopyridine-3-carboxylic acid
4,6-dimethyl-1-(1,2-oxazol-5-ylmethyl)-2-oxopyridine-3-carboxylic acid (PubChem CID 62861756) has the molecular formula C12H12N2O4
and a molecular weight of 248.24 g/mol. Its IUPAC name is 4,6-dimethyl-1-(1,2-oxazol-5-ylmethyl)-2-oxopyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 4,6-dimethyl-1-(1,2-oxazol-5-ylmethyl)-2-oxopyridine-3-carboxylic acid |
| PubChem CID | 62861756 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 4,6-dimethyl-1-(1,2-oxazol-5-ylmethyl)-2-oxopyridine-3-carboxylic acid |
| SMILES | Cc1cc(C)n(Cc2ccno2)c(=O)c1C(=O)O |
| InChI | InChI=1S/C12H12N2O4/c1-7-5-8(2)14(6-9-3-4-13-18-9)11(15)10(7)12(16)17/h3-5H,6H2,1-2H3,(H,16,17) |
| InChIKey | CWUFQHTZZJDKNU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,6-dimethyl-1-(1,2-oxazol-5-ylmethyl)-2-oxopyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-1-(1,2-oxazol-5-ylmethyl)-2-oxopyridine-3-carboxylic acid?
The IUPAC name of 4,6-dimethyl-1-(1,2-oxazol-5-ylmethyl)-2-oxopyridine-3-carboxylic acid (CID 62861756) is 4,6-dimethyl-1-(1,2-oxazol-5-ylmethyl)-2-oxopyridine-3-carboxylic acid.
What is the SMILES notation for 4,6-dimethyl-1-(1,2-oxazol-5-ylmethyl)-2-oxopyridine-3-carboxylic acid?
The canonical SMILES for 4,6-dimethyl-1-(1,2-oxazol-5-ylmethyl)-2-oxopyridine-3-carboxylic acid is Cc1cc(C)n(Cc2ccno2)c(=O)c1C(=O)O.
What is the InChIKey of 4,6-dimethyl-1-(1,2-oxazol-5-ylmethyl)-2-oxopyridine-3-carboxylic acid?
The InChIKey is CWUFQHTZZJDKNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O4/c1-7-5-8(2)14(6-9-3-4-13-18-9)11(15)10(7)12(16)17/h3-5H,6H2,1-2H3,(H,16,17).
What are the key properties of 4,6-dimethyl-1-(1,2-oxazol-5-ylmethyl)-2-oxopyridine-3-carboxylic acid?
4,6-dimethyl-1-(1,2-oxazol-5-ylmethyl)-2-oxopyridine-3-carboxylic acid has a molecular weight of 248.24 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-1-(1,2-oxazol-5-ylmethyl)-2-oxopyridine-3-carboxylic acid is sourced from PubChem (CID 62861756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).