C13H21N3 — CID 62862067
5-[[cyclobutylmethyl(methyl)amino]methyl]-N-methylpyridin-2-amine (PubChem CID 62862067) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 5-[[cyclobutylmethyl(methyl)amino]methyl]-N-methylpyridin-2-amine.
| Compound Name | 5-[[cyclobutylmethyl(methyl)amino]methyl]-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 62862067 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 5-[[cyclobutylmethyl(methyl)amino]methyl]-N-methylpyridin-2-amine |
| SMILES | CNc1ccc(CN(C)CC2CCC2)cn1 |
| InChI | InChI=1S/C13H21N3/c1-14-13-7-6-12(8-15-13)10-16(2)9-11-4-3-5-11/h6-8,11H,3-5,9-10H2,1-2H3,(H,14,15) |
| InChIKey | PUBQJARATCQKBY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |