C12H18N6O2 — CID 62862475
4,6-dimethoxy-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-1,3,5-triazin-2-amine (PubChem CID 62862475) has the molecular formula C12H18N6O2 and a molecular weight of 278.32 g/mol. Its IUPAC name is 4,6-dimethoxy-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dimethoxy-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 62862475 |
| Molecular Formula | C12H18N6O2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 4,6-dimethoxy-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-1,3,5-triazin-2-amine |
| SMILES | COc1nc(NCCCc2cn[nH]c2C)nc(OC)n1 |
| InChI | InChI=1S/C12H18N6O2/c1-8-9(7-14-18-8)5-4-6-13-10-15-11(19-2)17-12(16-10)20-3/h7H,4-6H2,1-3H3,(H,14,18)(H,13,15,16,17) |
| InChIKey | SDCWKPITDUEMGG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|