C11H13ClN6O — CID 62863362
4-chloro-6-imidazol-1-yl-N-(oxan-4-yl)-1,3,5-triazin-2-amine (PubChem CID 62863362) has the molecular formula C11H13ClN6O and a molecular weight of 280.72 g/mol. Its IUPAC name is 4-chloro-6-imidazol-1-yl-N-(oxan-4-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-imidazol-1-yl-N-(oxan-4-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 62863362 |
| Molecular Formula | C11H13ClN6O |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 4-chloro-6-imidazol-1-yl-N-(oxan-4-yl)-1,3,5-triazin-2-amine |
| SMILES | Clc1nc(NC2CCOCC2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C11H13ClN6O/c12-9-15-10(14-8-1-5-19-6-2-8)17-11(16-9)18-4-3-13-7-18/h3-4,7-8H,1-2,5-6H2,(H,14,15,16,17) |
| InChIKey | NRSMXPNNQJJECP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |