About 2-chloro-4-imidazol-1-yl-6-pyrazol-1-yl-1,3,5-triazine
2-chloro-4-imidazol-1-yl-6-pyrazol-1-yl-1,3,5-triazine (PubChem CID 62863484) has the molecular formula C9H6ClN7
and a molecular weight of 247.65 g/mol. Its IUPAC name is 2-chloro-4-imidazol-1-yl-6-pyrazol-1-yl-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-chloro-4-imidazol-1-yl-6-pyrazol-1-yl-1,3,5-triazine |
| PubChem CID | 62863484 |
| Molecular Formula | C9H6ClN7 |
| Molecular Weight | 247.65 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 2-chloro-4-imidazol-1-yl-6-pyrazol-1-yl-1,3,5-triazine |
| SMILES | Clc1nc(-n2ccnc2)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C9H6ClN7/c10-7-13-8(16-5-3-11-6-16)15-9(14-7)17-4-1-2-12-17/h1-6H |
| InChIKey | FZRALWGSJTZOEM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.65 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-chloro-4-imidazol-1-yl-6-pyrazol-1-yl-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-imidazol-1-yl-6-pyrazol-1-yl-1,3,5-triazine?
The IUPAC name of 2-chloro-4-imidazol-1-yl-6-pyrazol-1-yl-1,3,5-triazine (CID 62863484) is 2-chloro-4-imidazol-1-yl-6-pyrazol-1-yl-1,3,5-triazine.
What is the SMILES notation for 2-chloro-4-imidazol-1-yl-6-pyrazol-1-yl-1,3,5-triazine?
The canonical SMILES for 2-chloro-4-imidazol-1-yl-6-pyrazol-1-yl-1,3,5-triazine is Clc1nc(-n2ccnc2)nc(-n2cccn2)n1.
What is the InChIKey of 2-chloro-4-imidazol-1-yl-6-pyrazol-1-yl-1,3,5-triazine?
The InChIKey is FZRALWGSJTZOEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClN7/c10-7-13-8(16-5-3-11-6-16)15-9(14-7)17-4-1-2-12-17/h1-6H.
What are the key properties of 2-chloro-4-imidazol-1-yl-6-pyrazol-1-yl-1,3,5-triazine?
2-chloro-4-imidazol-1-yl-6-pyrazol-1-yl-1,3,5-triazine has a molecular weight of 247.65 g/mol, XLogP of 0.90, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-imidazol-1-yl-6-pyrazol-1-yl-1,3,5-triazine is sourced from PubChem (CID 62863484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).