C9H6ClN7 — CID 62863486
2-chloro-4,6-di(imidazol-1-yl)-1,3,5-triazine (PubChem CID 62863486) has the molecular formula C9H6ClN7 and a molecular weight of 247.65 g/mol. Its IUPAC name is 2-chloro-4,6-di(imidazol-1-yl)-1,3,5-triazine.
| Compound Name | 2-chloro-4,6-di(imidazol-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 62863486 |
| Molecular Formula | C9H6ClN7 |
| Molecular Weight | 247.65 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 2-chloro-4,6-di(imidazol-1-yl)-1,3,5-triazine |
| SMILES | Clc1nc(-n2ccnc2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C9H6ClN7/c10-7-13-8(16-3-1-11-5-16)15-9(14-7)17-4-2-12-6-17/h1-6H |
| InChIKey | REOAHANPEGTMOC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.65 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |