C12H17ClF3N5 — CID 62863617
6-chloro-2-N-cyclopropyl-4-N,4-N-diethyl-2-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 62863617) has the molecular formula C12H17ClF3N5 and a molecular weight of 323.75 g/mol. Its IUPAC name is 6-chloro-2-N-cyclopropyl-4-N,4-N-diethyl-2-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-cyclopropyl-4-N,4-N-diethyl-2-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 62863617 |
| Molecular Formula | C12H17ClF3N5 |
| Molecular Weight | 323.75 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 6-chloro-2-N-cyclopropyl-4-N,4-N-diethyl-2-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(Cl)nc(N(CC(F)(F)F)C2CC2)n1 |
| InChI | InChI=1S/C12H17ClF3N5/c1-3-20(4-2)10-17-9(13)18-11(19-10)21(8-5-6-8)7-12(14,15)16/h8H,3-7H2,1-2H3 |
| InChIKey | XJXBWDQXSZULTK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.75 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |