C11H20ClN5O2S — CID 62863799
6-chloro-2-N,2-N-diethyl-4-N-(3-methylsulfonylpropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 62863799) has the molecular formula C11H20ClN5O2S and a molecular weight of 321.83 g/mol. Its IUPAC name is 6-chloro-2-N,2-N-diethyl-4-N-(3-methylsulfonylpropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,2-N-diethyl-4-N-(3-methylsulfonylpropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 62863799 |
| Molecular Formula | C11H20ClN5O2S |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 6-chloro-2-N,2-N-diethyl-4-N-(3-methylsulfonylpropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(Cl)nc(NCCCS(C)(=O)=O)n1 |
| InChI | InChI=1S/C11H20ClN5O2S/c1-4-17(5-2)11-15-9(12)14-10(16-11)13-7-6-8-20(3,18)19/h4-8H2,1-3H3,(H,13,14,15,16) |
| InChIKey | SNTJMKUQCINPIS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|