C24H23N3O2 — CID 6286459
3a-[(E)-2-(6-methoxyquinolin-3-yl)ethenyl]-4,4-dimethyl-1,3-dihydroimidazo[1,2-a]indol-2-one (PubChem CID 6286459) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 3a-[(E)-2-(6-methoxyquinolin-3-yl)ethenyl]-4,4-dimethyl-1,3-dihydroimidazo[1,2-a]indol-2-one.
| Compound Name | 3a-[(E)-2-(6-methoxyquinolin-3-yl)ethenyl]-4,4-dimethyl-1,3-dihydroimidazo[1,2-a]indol-2-one |
|---|---|
| PubChem CID | 6286459 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 3a-[(E)-2-(6-methoxyquinolin-3-yl)ethenyl]-4,4-dimethyl-1,3-dihydroimidazo[1,2-a]indol-2-one |
| SMILES | COc1ccc2ncc(/C=C/C34NC(=O)CN3c3ccccc3C4(C)C)cc2c1 |
| InChI | InChI=1S/C24H23N3O2/c1-23(2)19-6-4-5-7-21(19)27-15-22(28)26-24(23,27)11-10-16-12-17-13-18(29-3)8-9-20(17)25-14-16/h4-14H,15H2,1-3H3,(H,26,28)/b11-10+ |
| InChIKey | AAHHTLIZFZOYIZ-ZHACJKMWSA-N |
| XLogP | 3.88 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|