C13H15ClN6O — CID 62865189
4-(4-chloro-6-pyrazol-1-yl-1,3,5-triazin-2-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 62865189) has the molecular formula C13H15ClN6O and a molecular weight of 306.76 g/mol. Its IUPAC name is 4-(4-chloro-6-pyrazol-1-yl-1,3,5-triazin-2-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | 4-(4-chloro-6-pyrazol-1-yl-1,3,5-triazin-2-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 62865189 |
| Molecular Formula | C13H15ClN6O |
| Molecular Weight | 306.76 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-(4-chloro-6-pyrazol-1-yl-1,3,5-triazin-2-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | Clc1nc(N2CCOC3CCCC32)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C13H15ClN6O/c14-11-16-12(18-13(17-11)20-6-2-5-15-20)19-7-8-21-10-4-1-3-9(10)19/h2,5-6,9-10H,1,3-4,7-8H2 |
| InChIKey | UXVAAKTZILWGOV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.76 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |