C9H9ClN4OS2 — CID 62866164
2-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)sulfanyl]-1,3-thiazole (PubChem CID 62866164) has the molecular formula C9H9ClN4OS2 and a molecular weight of 288.79 g/mol. Its IUPAC name is 2-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)sulfanyl]-1,3-thiazole.
| Compound Name | 2-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)sulfanyl]-1,3-thiazole |
|---|---|
| PubChem CID | 62866164 |
| Molecular Formula | C9H9ClN4OS2 |
| Molecular Weight | 288.79 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 2-[(4-chloro-6-propoxy-1,3,5-triazin-2-yl)sulfanyl]-1,3-thiazole |
| SMILES | CCCOc1nc(Cl)nc(Sc2nccs2)n1 |
| InChI | InChI=1S/C9H9ClN4OS2/c1-2-4-15-7-12-6(10)13-8(14-7)17-9-11-3-5-16-9/h3,5H,2,4H2,1H3 |
| InChIKey | RYGGIIPAIAVHNR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.79 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|