About 2-(3-bromophenyl)sulfanyl-4-chloro-6-pyrazol-1-yl-1,3,5-triazine
2-(3-bromophenyl)sulfanyl-4-chloro-6-pyrazol-1-yl-1,3,5-triazine (PubChem CID 62866172) has the molecular formula C12H7BrClN5S
and a molecular weight of 368.65 g/mol. Its IUPAC name is 2-(3-bromophenyl)sulfanyl-4-chloro-6-pyrazol-1-yl-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-(3-bromophenyl)sulfanyl-4-chloro-6-pyrazol-1-yl-1,3,5-triazine |
| PubChem CID | 62866172 |
| Molecular Formula | C12H7BrClN5S |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 366.93 |
| IUPAC Name | 2-(3-bromophenyl)sulfanyl-4-chloro-6-pyrazol-1-yl-1,3,5-triazine |
| SMILES | Clc1nc(Sc2cccc(Br)c2)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C12H7BrClN5S/c13-8-3-1-4-9(7-8)20-12-17-10(14)16-11(18-12)19-6-2-5-15-19/h1-7H |
| InChIKey | FFDUXSSPKJOWPA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-bromophenyl)sulfanyl-4-chloro-6-pyrazol-1-yl-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromophenyl)sulfanyl-4-chloro-6-pyrazol-1-yl-1,3,5-triazine?
The IUPAC name of 2-(3-bromophenyl)sulfanyl-4-chloro-6-pyrazol-1-yl-1,3,5-triazine (CID 62866172) is 2-(3-bromophenyl)sulfanyl-4-chloro-6-pyrazol-1-yl-1,3,5-triazine.
What is the SMILES notation for 2-(3-bromophenyl)sulfanyl-4-chloro-6-pyrazol-1-yl-1,3,5-triazine?
The canonical SMILES for 2-(3-bromophenyl)sulfanyl-4-chloro-6-pyrazol-1-yl-1,3,5-triazine is Clc1nc(Sc2cccc(Br)c2)nc(-n2cccn2)n1.
What is the InChIKey of 2-(3-bromophenyl)sulfanyl-4-chloro-6-pyrazol-1-yl-1,3,5-triazine?
The InChIKey is FFDUXSSPKJOWPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrClN5S/c13-8-3-1-4-9(7-8)20-12-17-10(14)16-11(18-12)19-6-2-5-15-19/h1-7H.
What are the key properties of 2-(3-bromophenyl)sulfanyl-4-chloro-6-pyrazol-1-yl-1,3,5-triazine?
2-(3-bromophenyl)sulfanyl-4-chloro-6-pyrazol-1-yl-1,3,5-triazine has a molecular weight of 368.65 g/mol, XLogP of 3.62, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromophenyl)sulfanyl-4-chloro-6-pyrazol-1-yl-1,3,5-triazine is sourced from PubChem (CID 62866172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).