C10H12ClN5S2 — CID 62866701
4-chloro-N,N-diethyl-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine (PubChem CID 62866701) has the molecular formula C10H12ClN5S2 and a molecular weight of 301.83 g/mol. Its IUPAC name is 4-chloro-N,N-diethyl-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N,N-diethyl-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 62866701 |
| Molecular Formula | C10H12ClN5S2 |
| Molecular Weight | 301.83 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 4-chloro-N,N-diethyl-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine |
| SMILES | CCN(CC)c1nc(Cl)nc(Sc2nccs2)n1 |
| InChI | InChI=1S/C10H12ClN5S2/c1-3-16(4-2)8-13-7(11)14-9(15-8)18-10-12-5-6-17-10/h5-6H,3-4H2,1-2H3 |
| InChIKey | PRFOXRCWHZCZAH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.83 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|