About 2-chloro-4-(2-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazine
2-chloro-4-(2-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazine (PubChem CID 62867554) has the molecular formula C14H14Cl2N4S
and a molecular weight of 341.27 g/mol. Its IUPAC name is 2-chloro-4-(2-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-chloro-4-(2-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazine |
| PubChem CID | 62867554 |
| Molecular Formula | C14H14Cl2N4S |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 2-chloro-4-(2-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazine |
| SMILES | Clc1nc(Sc2ccccc2Cl)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C14H14Cl2N4S/c15-10-6-2-3-7-11(10)21-14-18-12(16)17-13(19-14)20-8-4-1-5-9-20/h2-3,6-7H,1,4-5,8-9H2 |
| InChIKey | KGWMGDFTTSPXFY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-4-(2-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(2-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazine?
The IUPAC name of 2-chloro-4-(2-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazine (CID 62867554) is 2-chloro-4-(2-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazine.
What is the SMILES notation for 2-chloro-4-(2-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazine?
The canonical SMILES for 2-chloro-4-(2-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazine is Clc1nc(Sc2ccccc2Cl)nc(N2CCCCC2)n1.
What is the InChIKey of 2-chloro-4-(2-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazine?
The InChIKey is KGWMGDFTTSPXFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl2N4S/c15-10-6-2-3-7-11(10)21-14-18-12(16)17-13(19-14)20-8-4-1-5-9-20/h2-3,6-7H,1,4-5,8-9H2.
What are the key properties of 2-chloro-4-(2-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazine?
2-chloro-4-(2-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazine has a molecular weight of 341.27 g/mol, XLogP of 4.32, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(2-chlorophenyl)sulfanyl-6-piperidin-1-yl-1,3,5-triazine is sourced from PubChem (CID 62867554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).