C15H13BrF2O3 — CID 62867633
(2-bromo-5-fluorophenyl)-(2-fluoro-4,5-dimethoxyphenyl)methanol (PubChem CID 62867633) has the molecular formula C15H13BrF2O3 and a molecular weight of 359.17 g/mol. Its IUPAC name is (2-bromo-5-fluorophenyl)-(2-fluoro-4,5-dimethoxyphenyl)methanol.
| Compound Name | (2-bromo-5-fluorophenyl)-(2-fluoro-4,5-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 62867633 |
| Molecular Formula | C15H13BrF2O3 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | (2-bromo-5-fluorophenyl)-(2-fluoro-4,5-dimethoxyphenyl)methanol |
| SMILES | COc1cc(F)c(C(O)c2cc(F)ccc2Br)cc1OC |
| InChI | InChI=1S/C15H13BrF2O3/c1-20-13-6-10(12(18)7-14(13)21-2)15(19)9-5-8(17)3-4-11(9)16/h3-7,15,19H,1-2H3 |
| InChIKey | OLOCBWVJOBRQBW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |