C15H14F3NO2 — CID 62867795
(2,4-difluorophenyl)-(2-fluoro-4,5-dimethoxyphenyl)methanamine (PubChem CID 62867795) has the molecular formula C15H14F3NO2 and a molecular weight of 297.28 g/mol. Its IUPAC name is (2,4-difluorophenyl)-(2-fluoro-4,5-dimethoxyphenyl)methanamine.
| Compound Name | (2,4-difluorophenyl)-(2-fluoro-4,5-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 62867795 |
| Molecular Formula | C15H14F3NO2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (2,4-difluorophenyl)-(2-fluoro-4,5-dimethoxyphenyl)methanamine |
| SMILES | COc1cc(F)c(C(N)c2ccc(F)cc2F)cc1OC |
| InChI | InChI=1S/C15H14F3NO2/c1-20-13-6-10(12(18)7-14(13)21-2)15(19)9-4-3-8(16)5-11(9)17/h3-7,15H,19H2,1-2H3 |
| InChIKey | UQDZHHOFKLDBOO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |