About 2-chloro-4-(3-cyclopropylpyrazol-1-yl)-6-propan-2-yloxy-1,3,5-triazine
2-chloro-4-(3-cyclopropylpyrazol-1-yl)-6-propan-2-yloxy-1,3,5-triazine (PubChem CID 62868053) has the molecular formula C12H14ClN5O
and a molecular weight of 279.73 g/mol. Its IUPAC name is 2-chloro-4-(3-cyclopropylpyrazol-1-yl)-6-propan-2-yloxy-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-chloro-4-(3-cyclopropylpyrazol-1-yl)-6-propan-2-yloxy-1,3,5-triazine |
| PubChem CID | 62868053 |
| Molecular Formula | C12H14ClN5O |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-chloro-4-(3-cyclopropylpyrazol-1-yl)-6-propan-2-yloxy-1,3,5-triazine |
| SMILES | CC(C)Oc1nc(Cl)nc(-n2ccc(C3CC3)n2)n1 |
| InChI | InChI=1S/C12H14ClN5O/c1-7(2)19-12-15-10(13)14-11(16-12)18-6-5-9(17-18)8-3-4-8/h5-8H,3-4H2,1-2H3 |
| InChIKey | MILNILBMEDFXGW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-chloro-4-(3-cyclopropylpyrazol-1-yl)-6-propan-2-yloxy-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(3-cyclopropylpyrazol-1-yl)-6-propan-2-yloxy-1,3,5-triazine?
The IUPAC name of 2-chloro-4-(3-cyclopropylpyrazol-1-yl)-6-propan-2-yloxy-1,3,5-triazine (CID 62868053) is 2-chloro-4-(3-cyclopropylpyrazol-1-yl)-6-propan-2-yloxy-1,3,5-triazine.
What is the SMILES notation for 2-chloro-4-(3-cyclopropylpyrazol-1-yl)-6-propan-2-yloxy-1,3,5-triazine?
The canonical SMILES for 2-chloro-4-(3-cyclopropylpyrazol-1-yl)-6-propan-2-yloxy-1,3,5-triazine is CC(C)Oc1nc(Cl)nc(-n2ccc(C3CC3)n2)n1.
What is the InChIKey of 2-chloro-4-(3-cyclopropylpyrazol-1-yl)-6-propan-2-yloxy-1,3,5-triazine?
The InChIKey is MILNILBMEDFXGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN5O/c1-7(2)19-12-15-10(13)14-11(16-12)18-6-5-9(17-18)8-3-4-8/h5-8H,3-4H2,1-2H3.
What are the key properties of 2-chloro-4-(3-cyclopropylpyrazol-1-yl)-6-propan-2-yloxy-1,3,5-triazine?
2-chloro-4-(3-cyclopropylpyrazol-1-yl)-6-propan-2-yloxy-1,3,5-triazine has a molecular weight of 279.73 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(3-cyclopropylpyrazol-1-yl)-6-propan-2-yloxy-1,3,5-triazine is sourced from PubChem (CID 62868053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).