C6H2Cl2N4S2 — CID 62870803
2-[(4,6-dichloro-1,3,5-triazin-2-yl)sulfanyl]-1,3-thiazole (PubChem CID 62870803) has the molecular formula C6H2Cl2N4S2 and a molecular weight of 265.15 g/mol. Its IUPAC name is 2-[(4,6-dichloro-1,3,5-triazin-2-yl)sulfanyl]-1,3-thiazole.
| Compound Name | 2-[(4,6-dichloro-1,3,5-triazin-2-yl)sulfanyl]-1,3-thiazole |
|---|---|
| PubChem CID | 62870803 |
| Molecular Formula | C6H2Cl2N4S2 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 263.91 |
| IUPAC Name | 2-[(4,6-dichloro-1,3,5-triazin-2-yl)sulfanyl]-1,3-thiazole |
| SMILES | Clc1nc(Cl)nc(Sc2nccs2)n1 |
| InChI | InChI=1S/C6H2Cl2N4S2/c7-3-10-4(8)12-5(11-3)14-6-9-1-2-13-6/h1-2H |
| InChIKey | HJMFKXPRLGSHSX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|