C12H18N2O2S2 — CID 62871608
N-methyl-3-(thian-3-ylamino)benzenesulfonamide (PubChem CID 62871608) has the molecular formula C12H18N2O2S2 and a molecular weight of 286.42 g/mol. Its IUPAC name is N-methyl-3-(thian-3-ylamino)benzenesulfonamide.
| Compound Name | N-methyl-3-(thian-3-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 62871608 |
| Molecular Formula | C12H18N2O2S2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | N-methyl-3-(thian-3-ylamino)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cccc(NC2CCCSC2)c1 |
| InChI | InChI=1S/C12H18N2O2S2/c1-13-18(15,16)12-6-2-4-10(8-12)14-11-5-3-7-17-9-11/h2,4,6,8,11,13-14H,3,5,7,9H2,1H3 |
| InChIKey | OEUDSUXEZZSYDF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |