C13H18N2OS — CID 62872924
3-(4-methylanilino)thiane-3-carboxamide (PubChem CID 62872924) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 3-(4-methylanilino)thiane-3-carboxamide.
| Compound Name | 3-(4-methylanilino)thiane-3-carboxamide |
|---|---|
| PubChem CID | 62872924 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-(4-methylanilino)thiane-3-carboxamide |
| SMILES | Cc1ccc(NC2(C(N)=O)CCCSC2)cc1 |
| InChI | InChI=1S/C13H18N2OS/c1-10-3-5-11(6-4-10)15-13(12(14)16)7-2-8-17-9-13/h3-6,15H,2,7-9H2,1H3,(H2,14,16) |
| InChIKey | HBVZKDBWHRFRMJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |