C12H12F3N3O2 — CID 62874514
5-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pentanoic acid (PubChem CID 62874514) has the molecular formula C12H12F3N3O2 and a molecular weight of 287.24 g/mol. Its IUPAC name is 5-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pentanoic acid.
| Compound Name | 5-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 62874514 |
| Molecular Formula | C12H12F3N3O2 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 5-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1nnc2ccc(C(F)(F)F)cn12 |
| InChI | InChI=1S/C12H12F3N3O2/c13-12(14,15)8-5-6-10-17-16-9(18(10)7-8)3-1-2-4-11(19)20/h5-7H,1-4H2,(H,19,20) |
| InChIKey | MFUKWJYHURJUND-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|